C21H19Cl2N5O2 — CID 86828184
1-(3,4-dichlorophenyl)-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyrrolidine-3-carboxamide (PubChem CID 86828184) has the molecular formula C21H19Cl2N5O2 and a molecular weight of 444.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86828184 |
| Molecular Formula | C21H19Cl2N5O2 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCN(c2ccc(Cl)c(Cl)c2)C1=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C21H19Cl2N5O2/c1-13(14-2-4-15(5-3-14)28-12-24-11-25-28)26-20(29)17-8-9-27(21(17)30)16-6-7-18(22)19(23)10-16/h2-7,10-13,17H,8-9H2,1H3,(H,26,29) |
| InChIKey | RCWDCVOHJACSIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|