C12H18F3N3OS — CID 86829416
2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 86829416) has the molecular formula C12H18F3N3OS and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 86829416 |
| Molecular Formula | C12H18F3N3OS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | FC(F)(F)COCCCN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C12H18F3N3OS/c13-12(14,15)10-19-8-1-3-17-4-6-18(7-5-17)11-16-2-9-20-11/h2,9H,1,3-8,10H2 |
| InChIKey | UFQZZGOAVLWLDR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|