C23H26N2O2S — CID 86833054
[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]-[4-(methylsulfanylmethyl)phenyl]methanone (PubChem CID 86833054) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is [4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]-[4-(methylsulfanylmethyl)phenyl]methanone.
| Compound Name | [4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]-[4-(methylsulfanylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 86833054 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]-[4-(methylsulfanylmethyl)phenyl]methanone |
| SMILES | COc1ccc2[nH]cc(C3CCN(C(=O)c4ccc(CSC)cc4)CC3)c2c1 |
| InChI | InChI=1S/C23H26N2O2S/c1-27-19-7-8-22-20(13-19)21(14-24-22)17-9-11-25(12-10-17)23(26)18-5-3-16(4-6-18)15-28-2/h3-8,13-14,17,24H,9-12,15H2,1-2H3 |
| InChIKey | DKTPUDCUAUSCHK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |