C20H22N2O4 — CID 86834370
methyl 1-[(2-phenylmethoxypyridine-4-carbonyl)amino]cyclopentane-1-carboxylate (PubChem CID 86834370) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 1-[(2-phenylmethoxypyridine-4-carbonyl)amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[(2-phenylmethoxypyridine-4-carbonyl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86834370 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 1-[(2-phenylmethoxypyridine-4-carbonyl)amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccnc(OCc3ccccc3)c2)CCCC1 |
| InChI | InChI=1S/C20H22N2O4/c1-25-19(24)20(10-5-6-11-20)22-18(23)16-9-12-21-17(13-16)26-14-15-7-3-2-4-8-15/h2-4,7-9,12-13H,5-6,10-11,14H2,1H3,(H,22,23) |
| InChIKey | WFESMMLBICYRIA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |