C18H20N2O4S — CID 60566835
N-[(1,1-dioxothiolan-3-yl)methyl]-2-phenylmethoxypyridine-4-carboxamide (PubChem CID 60566835) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-2-phenylmethoxypyridine-4-carboxamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2-phenylmethoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 60566835 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2-phenylmethoxypyridine-4-carboxamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)c1ccnc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O4S/c21-18(20-11-15-7-9-25(22,23)13-15)16-6-8-19-17(10-16)24-12-14-4-2-1-3-5-14/h1-6,8,10,15H,7,9,11-13H2,(H,20,21) |
| InChIKey | YFNNSYVSVRZBND-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |