C18H21N3O3S — CID 97316430
N-benzyl-4-[[(3R)-1,1-dioxothiolan-3-yl]methylamino]pyridine-2-carboxamide (PubChem CID 97316430) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-benzyl-4-[[(3R)-1,1-dioxothiolan-3-yl]methylamino]pyridine-2-carboxamide.
| Compound Name | N-benzyl-4-[[(3R)-1,1-dioxothiolan-3-yl]methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97316430 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-benzyl-4-[[(3R)-1,1-dioxothiolan-3-yl]methylamino]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(NC[C@H]2CCS(=O)(=O)C2)ccn1 |
| InChI | InChI=1S/C18H21N3O3S/c22-18(21-11-14-4-2-1-3-5-14)17-10-16(6-8-19-17)20-12-15-7-9-25(23,24)13-15/h1-6,8,10,15H,7,9,11-13H2,(H,19,20)(H,21,22)/t15-/m1/s1 |
| InChIKey | QTAOQEQXNNKTHP-OAHLLOKOSA-N |
| XLogP | 1.86 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |