C23H24N4O2 — CID 86839804
N-[2-(1-benzylimidazol-2-yl)ethyl]-4-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 86839804) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(1-benzylimidazol-2-yl)ethyl]-4-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-4-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 86839804 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-4-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)NCCc2nccn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N4O2/c1-2-22(28)26-16-18-8-10-20(11-9-18)23(29)25-13-12-21-24-14-15-27(21)17-19-6-4-3-5-7-19/h2-11,14-15H,1,12-13,16-17H2,(H,25,29)(H,26,28) |
| InChIKey | YWZONVQGGVPKRB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|