C16H13ClF2N4O4 — CID 86843594
2-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-(3,4-difluorophenyl)-N-methylacetamide (PubChem CID 86843594) has the molecular formula C16H13ClF2N4O4 and a molecular weight of 398.75 g/mol. Its IUPAC name is 2-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-(3,4-difluorophenyl)-N-methylacetamide.
| Compound Name | 2-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-(3,4-difluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 86843594 |
| Molecular Formula | C16H13ClF2N4O4 |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-(3,4-difluorophenyl)-N-methylacetamide |
| SMILES | CNC(=O)C(NC(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13ClF2N4O4/c1-20-15(24)14(8-2-4-11(18)12(19)6-8)22-16(25)21-13-5-3-9(23(26)27)7-10(13)17/h2-7,14H,1H3,(H,20,24)(H2,21,22,25) |
| InChIKey | ZMGJCCIZSSZPOI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|