C23H18F2N2O2 — CID 86843668
N-(2,4-difluoro-6-phenylphenyl)-2-(5-methoxyindol-1-yl)acetamide (PubChem CID 86843668) has the molecular formula C23H18F2N2O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-(2,4-difluoro-6-phenylphenyl)-2-(5-methoxyindol-1-yl)acetamide.
| Compound Name | N-(2,4-difluoro-6-phenylphenyl)-2-(5-methoxyindol-1-yl)acetamide |
|---|---|
| PubChem CID | 86843668 |
| Molecular Formula | C23H18F2N2O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(2,4-difluoro-6-phenylphenyl)-2-(5-methoxyindol-1-yl)acetamide |
| SMILES | COc1ccc2c(ccn2CC(=O)Nc2c(F)cc(F)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H18F2N2O2/c1-29-18-7-8-21-16(11-18)9-10-27(21)14-22(28)26-23-19(12-17(24)13-20(23)25)15-5-3-2-4-6-15/h2-13H,14H2,1H3,(H,26,28) |
| InChIKey | PTCXCFDEDUIXOR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |