C17H14F2N2O2 — CID 87042646
N-(3,5-difluoro-4-methoxyphenyl)-2-indol-1-ylacetamide (PubChem CID 87042646) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is N-(3,5-difluoro-4-methoxyphenyl)-2-indol-1-ylacetamide.
| Compound Name | N-(3,5-difluoro-4-methoxyphenyl)-2-indol-1-ylacetamide |
|---|---|
| PubChem CID | 87042646 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(3,5-difluoro-4-methoxyphenyl)-2-indol-1-ylacetamide |
| SMILES | COc1c(F)cc(NC(=O)Cn2ccc3ccccc32)cc1F |
| InChI | InChI=1S/C17H14F2N2O2/c1-23-17-13(18)8-12(9-14(17)19)20-16(22)10-21-7-6-11-4-2-3-5-15(11)21/h2-9H,10H2,1H3,(H,20,22) |
| InChIKey | BDWDOEFVNIPFAS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |