C19H24N2O2 — CID 86845360
1-(4-prop-2-enoxyphenyl)-N-[(2-propoxy-3-pyridinyl)methyl]methanamine (PubChem CID 86845360) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(4-prop-2-enoxyphenyl)-N-[(2-propoxy-3-pyridinyl)methyl]methanamine.
| Compound Name | 1-(4-prop-2-enoxyphenyl)-N-[(2-propoxy-3-pyridinyl)methyl]methanamine |
|---|---|
| PubChem CID | 86845360 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(4-prop-2-enoxyphenyl)-N-[(2-propoxy-3-pyridinyl)methyl]methanamine |
| SMILES | C=CCOc1ccc(CNCc2cccnc2OCCC)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-3-12-22-18-9-7-16(8-10-18)14-20-15-17-6-5-11-21-19(17)23-13-4-2/h3,5-11,20H,1,4,12-15H2,2H3 |
| InChIKey | AKZLENFSHSHJMX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|