C18H17N5O4 — CID 86853274
5-methyl-N-[(3-nitrophenyl)methyl]-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide (PubChem CID 86853274) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 5-methyl-N-[(3-nitrophenyl)methyl]-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide.
| Compound Name | 5-methyl-N-[(3-nitrophenyl)methyl]-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide |
|---|---|
| PubChem CID | 86853274 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 5-methyl-N-[(3-nitrophenyl)methyl]-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide |
| SMILES | CC1N=C(C(=O)NCc2cccc([N+](=O)[O-])c2)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H17N5O4/c1-12-18(25)22(14-7-3-2-4-8-14)21-16(20-12)17(24)19-11-13-6-5-9-15(10-13)23(26)27/h2-10,12H,11H2,1H3,(H,19,24)(H,20,21) |
| InChIKey | MJKDJEOWBYXUJG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|