C20H19N3O3 — CID 86876376
N-[(3-nitrophenyl)methyl]-1-(2-phenylethyl)pyrrole-2-carboxamide (PubChem CID 86876376) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-1-(2-phenylethyl)pyrrole-2-carboxamide.
| Compound Name | N-[(3-nitrophenyl)methyl]-1-(2-phenylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86876376 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-1-(2-phenylethyl)pyrrole-2-carboxamide |
| SMILES | O=C(NCc1cccc([N+](=O)[O-])c1)c1cccn1CCc1ccccc1 |
| InChI | InChI=1S/C20H19N3O3/c24-20(21-15-17-8-4-9-18(14-17)23(25)26)19-10-5-12-22(19)13-11-16-6-2-1-3-7-16/h1-10,12,14H,11,13,15H2,(H,21,24) |
| InChIKey | OSOOOHIYWANJGQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|