C17H19N5OS — CID 86854952
N-(6-methyl-2-pyridinyl)-3-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propanamide (PubChem CID 86854952) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-3-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propanamide.
| Compound Name | N-(6-methyl-2-pyridinyl)-3-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 86854952 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-3-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propanamide |
| SMILES | Cc1cccc(NC(=O)CCNCc2cn[nH]c2-c2cccs2)n1 |
| InChI | InChI=1S/C17H19N5OS/c1-12-4-2-6-15(20-12)21-16(23)7-8-18-10-13-11-19-22-17(13)14-5-3-9-24-14/h2-6,9,11,18H,7-8,10H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | TZIKXFDUCFVRBE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|