C18H20N2O3 — CID 86862268
(5-methoxy-3-methyl-1-benzofuran-2-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone (PubChem CID 86862268) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (5-methoxy-3-methyl-1-benzofuran-2-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone.
| Compound Name | (5-methoxy-3-methyl-1-benzofuran-2-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 86862268 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (5-methoxy-3-methyl-1-benzofuran-2-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone |
| SMILES | C#CCN1CCN(C(=O)c2oc3ccc(OC)cc3c2C)CC1 |
| InChI | InChI=1S/C18H20N2O3/c1-4-7-19-8-10-20(11-9-19)18(21)17-13(2)15-12-14(22-3)5-6-16(15)23-17/h1,5-6,12H,7-11H2,2-3H3 |
| InChIKey | ULRXOJNVVKLREO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|