About [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate
[phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate (PubChem CID 86863216) has the molecular formula C19H18N2O3S
and a molecular weight of 354.43 g/mol. Its IUPAC name is [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate.
Molecular Properties
| Compound Name | [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate |
| PubChem CID | 86863216 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate |
| SMILES | Cc1csc(=O)n1CCC(=O)OC(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-14-13-25-19(23)21(14)12-9-17(22)24-18(15-5-3-2-4-6-15)16-7-10-20-11-8-16/h2-8,10-11,13,18H,9,12H2,1H3 |
| InChIKey | YUKNGNWGMYYDIQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate?
The IUPAC name of [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate (CID 86863216) is [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate.
What is the SMILES notation for [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate?
The canonical SMILES for [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate is Cc1csc(=O)n1CCC(=O)OC(c1ccccc1)c1ccncc1.
What is the InChIKey of [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate?
The InChIKey is YUKNGNWGMYYDIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3S/c1-14-13-25-19(23)21(14)12-9-17(22)24-18(15-5-3-2-4-6-15)16-7-10-20-11-8-16/h2-8,10-11,13,18H,9,12H2,1H3.
What are the key properties of [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate?
[phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate has a molecular weight of 354.43 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [phenyl(pyridin-4-yl)methyl] 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate is sourced from PubChem (CID 86863216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).