C20H33N5O — CID 86864363
N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-methylazepane-1-carboxamide (PubChem CID 86864363) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-methylazepane-1-carboxamide.
| Compound Name | N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-methylazepane-1-carboxamide |
|---|---|
| PubChem CID | 86864363 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-methylazepane-1-carboxamide |
| SMILES | CCN1CCN(c2ccc(CNC(=O)N3CCCC(C)CC3)cn2)CC1 |
| InChI | InChI=1S/C20H33N5O/c1-3-23-11-13-24(14-12-23)19-7-6-18(15-21-19)16-22-20(26)25-9-4-5-17(2)8-10-25/h6-7,15,17H,3-5,8-14,16H2,1-2H3,(H,22,26) |
| InChIKey | ZTUYVUGCNMIVRI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |