C21H33N5O — CID 87036049
2-cyclopentyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 87036049) has the molecular formula C21H33N5O and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-cyclopentyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87036049 |
| Molecular Formula | C21H33N5O |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | 2-cyclopentyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)N3CCCC3C3CCCC3)cn2)CC1 |
| InChI | InChI=1S/C21H33N5O/c1-24-11-13-25(14-12-24)20-9-8-17(15-22-20)16-23-21(27)26-10-4-7-19(26)18-5-2-3-6-18/h8-9,15,18-19H,2-7,10-14,16H2,1H3,(H,23,27) |
| InChIKey | PSYGEIPTCUVRIE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |