C17H24N4O — CID 154757862
N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2-azabicyclo[4.1.0]heptane-2-carboxamide (PubChem CID 154757862) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2-azabicyclo[4.1.0]heptane-2-carboxamide.
| Compound Name | N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2-azabicyclo[4.1.0]heptane-2-carboxamide |
|---|---|
| PubChem CID | 154757862 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2-azabicyclo[4.1.0]heptane-2-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2)nc1)N1CCCC2CC21 |
| InChI | InChI=1S/C17H24N4O/c22-17(21-9-3-4-14-10-15(14)21)19-12-13-5-6-16(18-11-13)20-7-1-2-8-20/h5-6,11,14-15H,1-4,7-10,12H2,(H,19,22) |
| InChIKey | XMOLTOBLHQMQPW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |