C20H30N4O — CID 119846500
3-amino-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119846500) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-amino-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119846500 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 3-amino-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)NCc1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C20H30N4O/c21-19-16-7-6-15(11-16)18(19)20(25)23-13-14-5-8-17(22-12-14)24-9-3-1-2-4-10-24/h5,8,12,15-16,18-19H,1-4,6-7,9-11,13,21H2,(H,23,25) |
| InChIKey | AVNLOQJAGIXHFA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |