C18H29N5O — CID 119901247
3-amino-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]cyclohexane-1-carboxamide (PubChem CID 119901247) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-amino-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119901247 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 3-amino-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]cyclohexane-1-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)C3CCCC(N)C3)cn2)CC1 |
| InChI | InChI=1S/C18H29N5O/c1-22-7-9-23(10-8-22)17-6-5-14(12-20-17)13-21-18(24)15-3-2-4-16(19)11-15/h5-6,12,15-16H,2-4,7-11,13,19H2,1H3,(H,21,24) |
| InChIKey | RHKYQVNZLKDDKF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |