C24H22N4O2 — CID 86864428
1-[(2-phenylmethoxy-4-pyridinyl)methyl]-3-(quinolin-8-ylmethyl)urea (PubChem CID 86864428) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-[(2-phenylmethoxy-4-pyridinyl)methyl]-3-(quinolin-8-ylmethyl)urea.
| Compound Name | 1-[(2-phenylmethoxy-4-pyridinyl)methyl]-3-(quinolin-8-ylmethyl)urea |
|---|---|
| PubChem CID | 86864428 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[(2-phenylmethoxy-4-pyridinyl)methyl]-3-(quinolin-8-ylmethyl)urea |
| SMILES | O=C(NCc1ccnc(OCc2ccccc2)c1)NCc1cccc2cccnc12 |
| InChI | InChI=1S/C24H22N4O2/c29-24(28-16-21-9-4-8-20-10-5-12-26-23(20)21)27-15-19-11-13-25-22(14-19)30-17-18-6-2-1-3-7-18/h1-14H,15-17H2,(H2,27,28,29) |
| InChIKey | OIGRCCHREBLCEG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |