C15H15F2N3O2 — CID 86867514
2,5-difluoro-N-[2-(oxolan-3-ylmethyl)pyrazol-3-yl]benzamide (PubChem CID 86867514) has the molecular formula C15H15F2N3O2 and a molecular weight of 307.30 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-(oxolan-3-ylmethyl)pyrazol-3-yl]benzamide.
| Compound Name | 2,5-difluoro-N-[2-(oxolan-3-ylmethyl)pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 86867514 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2,5-difluoro-N-[2-(oxolan-3-ylmethyl)pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccnn1CC1CCOC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H15F2N3O2/c16-11-1-2-13(17)12(7-11)15(21)19-14-3-5-18-20(14)8-10-4-6-22-9-10/h1-3,5,7,10H,4,6,8-9H2,(H,19,21) |
| InChIKey | HCBRQHWMKKASRZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |