C19H18FN3O2S — CID 95274554
5-(2-fluorophenyl)-N-[2-[[(3R)-oxolan-3-yl]methyl]pyrazol-3-yl]thiophene-2-carboxamide (PubChem CID 95274554) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[2-[[(3R)-oxolan-3-yl]methyl]pyrazol-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[2-[[(3R)-oxolan-3-yl]methyl]pyrazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95274554 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[2-[[(3R)-oxolan-3-yl]methyl]pyrazol-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccnn1C[C@H]1CCOC1)c1ccc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-15-4-2-1-3-14(15)16-5-6-17(26-16)19(24)22-18-7-9-21-23(18)11-13-8-10-25-12-13/h1-7,9,13H,8,10-12H2,(H,22,24)/t13-/m1/s1 |
| InChIKey | FUSHBJBSDWKXIO-CYBMUJFWSA-N |
| XLogP | 4.04 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |