C23H26N4O3S — CID 86869299
(E)-N-[1-(4-cyanophenyl)piperidin-4-yl]-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 86869299) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is (E)-N-[1-(4-cyanophenyl)piperidin-4-yl]-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(4-cyanophenyl)piperidin-4-yl]-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86869299 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (E)-N-[1-(4-cyanophenyl)piperidin-4-yl]-3-[4-(dimethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(/C=C/C(=O)NC2CCN(c3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-26(2)31(29,30)22-10-5-18(6-11-22)7-12-23(28)25-20-13-15-27(16-14-20)21-8-3-19(17-24)4-9-21/h3-12,20H,13-16H2,1-2H3,(H,25,28)/b12-7+ |
| InChIKey | CJHASPMJFDPQBP-KPKJPENVSA-N |
| XLogP | 2.61 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|