C20H26F3NO2S — CID 86873754
1-(4-cyclohexyloxypiperidin-1-yl)-2-[3-(trifluoromethyl)phenyl]sulfanylethanone (PubChem CID 86873754) has the molecular formula C20H26F3NO2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-(4-cyclohexyloxypiperidin-1-yl)-2-[3-(trifluoromethyl)phenyl]sulfanylethanone.
| Compound Name | 1-(4-cyclohexyloxypiperidin-1-yl)-2-[3-(trifluoromethyl)phenyl]sulfanylethanone |
|---|---|
| PubChem CID | 86873754 |
| Molecular Formula | C20H26F3NO2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-(4-cyclohexyloxypiperidin-1-yl)-2-[3-(trifluoromethyl)phenyl]sulfanylethanone |
| SMILES | O=C(CSc1cccc(C(F)(F)F)c1)N1CCC(OC2CCCCC2)CC1 |
| InChI | InChI=1S/C20H26F3NO2S/c21-20(22,23)15-5-4-8-18(13-15)27-14-19(25)24-11-9-17(10-12-24)26-16-6-2-1-3-7-16/h4-5,8,13,16-17H,1-3,6-7,9-12,14H2 |
| InChIKey | IRKZBBYVMNZNRN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |