C23H26FN3O — CID 86874234
2-(1-ethylindol-3-yl)-1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 86874234) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-(1-ethylindol-3-yl)-1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(1-ethylindol-3-yl)-1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 86874234 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-(1-ethylindol-3-yl)-1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCn1cc(CC(=O)N2CCCN(c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H26FN3O/c1-2-25-17-18(21-6-3-4-7-22(21)25)16-23(28)27-13-5-12-26(14-15-27)20-10-8-19(24)9-11-20/h3-4,6-11,17H,2,5,12-16H2,1H3 |
| InChIKey | MEVBNHMOKDDDQN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |