About N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide
N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide (PubChem CID 86875187) has the molecular formula C19H17FN2OS3
and a molecular weight of 404.56 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide |
| PubChem CID | 86875187 |
| Molecular Formula | C19H17FN2OS3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(C1CSCCS1)N(Cc1ccc(F)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17FN2OS3/c20-14-7-5-13(6-8-14)11-22(18(23)17-12-24-9-10-25-17)19-21-15-3-1-2-4-16(15)26-19/h1-8,17H,9-12H2 |
| InChIKey | DTFADIYJCRUSBF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide?
The IUPAC name of N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide (CID 86875187) is N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide.
What is the SMILES notation for N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide?
The canonical SMILES for N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide is O=C(C1CSCCS1)N(Cc1ccc(F)cc1)c1nc2ccccc2s1.
What is the InChIKey of N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide?
The InChIKey is DTFADIYJCRUSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2OS3/c20-14-7-5-13(6-8-14)11-22(18(23)17-12-24-9-10-25-17)19-21-15-3-1-2-4-16(15)26-19/h1-8,17H,9-12H2.
What are the key properties of N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide?
N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide has a molecular weight of 404.56 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]-1,4-dithiane-2-carboxamide is sourced from PubChem (CID 86875187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).