C19H23BrN2O — CID 86877152
2-(3-bromophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide (PubChem CID 86877152) has the molecular formula C19H23BrN2O and a molecular weight of 375.31 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 86877152 |
| Molecular Formula | C19H23BrN2O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(3-bromophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide |
| SMILES | CN(C)c1ccc(CCCNC(=O)Cc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H23BrN2O/c1-22(2)18-10-8-15(9-11-18)6-4-12-21-19(23)14-16-5-3-7-17(20)13-16/h3,5,7-11,13H,4,6,12,14H2,1-2H3,(H,21,23) |
| InChIKey | KJHCHTNPKVDBGE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|