C18H17Cl2N3O3S — CID 86877804
N-[2-(2,3-dichlorophenyl)ethyl]-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide (PubChem CID 86877804) has the molecular formula C18H17Cl2N3O3S and a molecular weight of 426.33 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenyl)ethyl]-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide.
| Compound Name | N-[2-(2,3-dichlorophenyl)ethyl]-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 86877804 |
| Molecular Formula | C18H17Cl2N3O3S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | N-[2-(2,3-dichlorophenyl)ethyl]-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2ccsc2)NC(=O)N(CC(=O)NCCc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C18H17Cl2N3O3S/c1-18(12-6-8-27-10-12)16(25)23(17(26)22-18)9-14(24)21-7-5-11-3-2-4-13(19)15(11)20/h2-4,6,8,10H,5,7,9H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | YYJQJRPHDLSQFN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|