C18H18FIN2O2 — CID 86877934
5-fluoro-N-[2-(4-hydroxypiperidin-1-yl)phenyl]-2-iodobenzamide (PubChem CID 86877934) has the molecular formula C18H18FIN2O2 and a molecular weight of 440.26 g/mol. Its IUPAC name is 5-fluoro-N-[2-(4-hydroxypiperidin-1-yl)phenyl]-2-iodobenzamide.
| Compound Name | 5-fluoro-N-[2-(4-hydroxypiperidin-1-yl)phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 86877934 |
| Molecular Formula | C18H18FIN2O2 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 5-fluoro-N-[2-(4-hydroxypiperidin-1-yl)phenyl]-2-iodobenzamide |
| SMILES | O=C(Nc1ccccc1N1CCC(O)CC1)c1cc(F)ccc1I |
| InChI | InChI=1S/C18H18FIN2O2/c19-12-5-6-15(20)14(11-12)18(24)21-16-3-1-2-4-17(16)22-9-7-13(23)8-10-22/h1-6,11,13,23H,7-10H2,(H,21,24) |
| InChIKey | QIKSWBMKVFKZJJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|