C24H24N2O4S — CID 86878500
N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-5-yl)-3-phenylmethoxybenzamide (PubChem CID 86878500) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-5-yl)-3-phenylmethoxybenzamide.
| Compound Name | N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-5-yl)-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 86878500 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-5-yl)-3-phenylmethoxybenzamide |
| SMILES | CS(=O)(=O)N1CCc2c(cccc2NC(=O)c2cccc(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C24H24N2O4S/c1-31(28,29)26-14-13-22-20(16-26)10-6-12-23(22)25-24(27)19-9-5-11-21(15-19)30-17-18-7-3-2-4-8-18/h2-12,15H,13-14,16-17H2,1H3,(H,25,27) |
| InChIKey | JDEVIVXBZJZDIW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |