C24H24N4O2 — CID 86879111
4-[[furan-2-ylmethyl-[(4-imidazol-1-ylphenyl)methyl]amino]methyl]-N-methylbenzamide (PubChem CID 86879111) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[[furan-2-ylmethyl-[(4-imidazol-1-ylphenyl)methyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[furan-2-ylmethyl-[(4-imidazol-1-ylphenyl)methyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 86879111 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-[[furan-2-ylmethyl-[(4-imidazol-1-ylphenyl)methyl]amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(Cc2ccc(-n3ccnc3)cc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-25-24(29)21-8-4-19(5-9-21)15-27(17-23-3-2-14-30-23)16-20-6-10-22(11-7-20)28-13-12-26-18-28/h2-14,18H,15-17H2,1H3,(H,25,29) |
| InChIKey | NGPDBXSNMDWQQF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |