C22H28N4O4 — CID 86880960
4-(5-methylfuran-2-carbonyl)-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxamide (PubChem CID 86880960) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-(5-methylfuran-2-carbonyl)-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(5-methylfuran-2-carbonyl)-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86880960 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 4-(5-methylfuran-2-carbonyl)-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)NCc3ccccc3N3CCOCC3)CC2)o1 |
| InChI | InChI=1S/C22H28N4O4/c1-17-6-7-20(30-17)21(27)25-8-10-26(11-9-25)22(28)23-16-18-4-2-3-5-19(18)24-12-14-29-15-13-24/h2-7H,8-16H2,1H3,(H,23,28) |
| InChIKey | SNHNBKMWSLJQNU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |