C22H28N4O4 — CID 86881160
N'-[3-(dimethylcarbamoyl)phenyl]-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]oxamide (PubChem CID 86881160) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N'-[3-(dimethylcarbamoyl)phenyl]-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]oxamide.
| Compound Name | N'-[3-(dimethylcarbamoyl)phenyl]-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 86881160 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N'-[3-(dimethylcarbamoyl)phenyl]-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]oxamide |
| SMILES | Cc1ccc(C(CNC(=O)C(=O)Nc2cccc(C(=O)N(C)C)c2)N2CCCC2)o1 |
| InChI | InChI=1S/C22H28N4O4/c1-15-9-10-19(30-15)18(26-11-4-5-12-26)14-23-20(27)21(28)24-17-8-6-7-16(13-17)22(29)25(2)3/h6-10,13,18H,4-5,11-12,14H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | CKFRCZJNODAUTE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|