C19H23ClN4O3S — CID 86882802
N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1,3-thiazol-2-yl)butanediamide (PubChem CID 86882802) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 86882802 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1nccs1)NCC(c1cccc(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H23ClN4O3S/c20-15-3-1-2-14(12-15)16(24-7-9-27-10-8-24)13-22-17(25)4-5-18(26)23-19-21-6-11-28-19/h1-3,6,11-12,16H,4-5,7-10,13H2,(H,22,25)(H,21,23,26) |
| InChIKey | GIVDFTIODVXQHT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |