C18H20ClN3O5S — CID 86884394
N-(2-chloro-4-methylphenyl)-3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]propanamide (PubChem CID 86884394) has the molecular formula C18H20ClN3O5S and a molecular weight of 425.89 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 86884394 |
| Molecular Formula | C18H20ClN3O5S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(NC(=O)CCNS(=O)(=O)c2cc(C)c(C)cc2[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O5S/c1-11-4-5-15(14(19)8-11)21-18(23)6-7-20-28(26,27)17-10-13(3)12(2)9-16(17)22(24)25/h4-5,8-10,20H,6-7H2,1-3H3,(H,21,23) |
| InChIKey | XIXAGUGMFLAJBL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|