C16H15Cl2FN2O3S — CID 86888312
3-[(2-chloro-5-fluorophenyl)sulfonylamino]-N-(2-chloro-4-methylphenyl)propanamide (PubChem CID 86888312) has the molecular formula C16H15Cl2FN2O3S and a molecular weight of 405.28 g/mol. Its IUPAC name is 3-[(2-chloro-5-fluorophenyl)sulfonylamino]-N-(2-chloro-4-methylphenyl)propanamide.
| Compound Name | 3-[(2-chloro-5-fluorophenyl)sulfonylamino]-N-(2-chloro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 86888312 |
| Molecular Formula | C16H15Cl2FN2O3S |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 3-[(2-chloro-5-fluorophenyl)sulfonylamino]-N-(2-chloro-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCNS(=O)(=O)c2cc(F)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2FN2O3S/c1-10-2-5-14(13(18)8-10)21-16(22)6-7-20-25(23,24)15-9-11(19)3-4-12(15)17/h2-5,8-9,20H,6-7H2,1H3,(H,21,22) |
| InChIKey | QKSZPWZMXOFBSU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |