C18H26FN3O2S — CID 86884511
N-(2-tert-butylsulfanylethyl)-4-(2-fluorobenzoyl)piperazine-1-carboxamide (PubChem CID 86884511) has the molecular formula C18H26FN3O2S and a molecular weight of 367.49 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-4-(2-fluorobenzoyl)piperazine-1-carboxamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-4-(2-fluorobenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86884511 |
| Molecular Formula | C18H26FN3O2S |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-4-(2-fluorobenzoyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26FN3O2S/c1-18(2,3)25-13-8-20-17(24)22-11-9-21(10-12-22)16(23)14-6-4-5-7-15(14)19/h4-7H,8-13H2,1-3H3,(H,20,24) |
| InChIKey | OOPUSDXVHICFTO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|