C21H17F3N4O3 — CID 86885102
3-[[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 86885102) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 3-[[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 86885102 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(=O)n(CC(=O)Nc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)n1 |
| InChI | InChI=1S/C21H17F3N4O3/c1-13-8-9-19(30)28(27-13)12-18(29)25-16-6-2-4-14(10-16)20(31)26-17-7-3-5-15(11-17)21(22,23)24/h2-11H,12H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | SRPYLRPJGPDWBC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |