C18H15Cl2N5O2S — CID 86885275
1-(2,6-dichlorophenyl)-5-ethyl-N-(7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 86885275) has the molecular formula C18H15Cl2N5O2S and a molecular weight of 436.32 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-ethyl-N-(7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)-5-ethyl-N-(7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 86885275 |
| Molecular Formula | C18H15Cl2N5O2S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-ethyl-N-(7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCc1nc(C(=O)Nc2nc3c(s2)C(=O)CCC3)nn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H15Cl2N5O2S/c1-2-13-22-16(24-25(13)14-9(19)5-3-6-10(14)20)17(27)23-18-21-11-7-4-8-12(26)15(11)28-18/h3,5-6H,2,4,7-8H2,1H3,(H,21,23,27) |
| InChIKey | XFQZOSFLXQVWFN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |