C22H20Cl2N8O2 — CID 95249476
1-(2,6-dichlorophenyl)-5-ethyl-N-[4-[[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]amino]phenyl]-1,2,4-triazole-3-carboxamide (PubChem CID 95249476) has the molecular formula C22H20Cl2N8O2 and a molecular weight of 499.36 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-ethyl-N-[4-[[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]amino]phenyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)-5-ethyl-N-[4-[[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]amino]phenyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 95249476 |
| Molecular Formula | C22H20Cl2N8O2 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-ethyl-N-[4-[[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]amino]phenyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCc1nc(C(=O)Nc2ccc(NC(=O)[C@H](C)n3cncn3)cc2)nn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H20Cl2N8O2/c1-3-18-29-20(30-32(18)19-16(23)5-4-6-17(19)24)22(34)28-15-9-7-14(8-10-15)27-21(33)13(2)31-12-25-11-26-31/h4-13H,3H2,1-2H3,(H,27,33)(H,28,34)/t13-/m0/s1 |
| InChIKey | JOYRVFKMZVYSKQ-ZDUSSCGKSA-N |
| XLogP | 4.18 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |