C19H23FN4O3S — CID 86886071
2-(4-fluorophenyl)-2-[4-[2-(methylsulfamoyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 86886071) has the molecular formula C19H23FN4O3S and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[4-[2-(methylsulfamoyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-2-[4-[2-(methylsulfamoyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 86886071 |
| Molecular Formula | C19H23FN4O3S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[4-[2-(methylsulfamoyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | CNS(=O)(=O)c1ccccc1N1CCN(C(C(N)=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H23FN4O3S/c1-22-28(26,27)17-5-3-2-4-16(17)23-10-12-24(13-11-23)18(19(21)25)14-6-8-15(20)9-7-14/h2-9,18,22H,10-13H2,1H3,(H2,21,25) |
| InChIKey | WVXKIGGUWHMHCM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |