C25H36N4O — CID 86886133
1-(3-methyl-2-phenylbutyl)-3-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]urea (PubChem CID 86886133) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-(3-methyl-2-phenylbutyl)-3-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]urea.
| Compound Name | 1-(3-methyl-2-phenylbutyl)-3-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 86886133 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-(3-methyl-2-phenylbutyl)-3-[2-(4-methylpiperazin-1-yl)-1-phenylethyl]urea |
| SMILES | CC(C)C(CNC(=O)NC(CN1CCN(C)CC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N4O/c1-20(2)23(21-10-6-4-7-11-21)18-26-25(30)27-24(22-12-8-5-9-13-22)19-29-16-14-28(3)15-17-29/h4-13,20,23-24H,14-19H2,1-3H3,(H2,26,27,30) |
| InChIKey | YTLDVOWCJOHHMJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |