C25H24FN3O3 — CID 86887352
N-[2-(3-anilinopyrrolidine-1-carbonyl)-5-fluorophenyl]-4-methoxybenzamide (PubChem CID 86887352) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[2-(3-anilinopyrrolidine-1-carbonyl)-5-fluorophenyl]-4-methoxybenzamide.
| Compound Name | N-[2-(3-anilinopyrrolidine-1-carbonyl)-5-fluorophenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 86887352 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[2-(3-anilinopyrrolidine-1-carbonyl)-5-fluorophenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(F)ccc2C(=O)N2CCC(Nc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H24FN3O3/c1-32-21-10-7-17(8-11-21)24(30)28-23-15-18(26)9-12-22(23)25(31)29-14-13-20(16-29)27-19-5-3-2-4-6-19/h2-12,15,20,27H,13-14,16H2,1H3,(H,28,30) |
| InChIKey | DJQJYYRENFQTCR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |