C25H23N5O2 — CID 86887909
5-cyclopropyl-1-(4-methylphenyl)-N-[4-(pyridin-3-ylmethoxy)phenyl]triazole-4-carboxamide (PubChem CID 86887909) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 5-cyclopropyl-1-(4-methylphenyl)-N-[4-(pyridin-3-ylmethoxy)phenyl]triazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-1-(4-methylphenyl)-N-[4-(pyridin-3-ylmethoxy)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 86887909 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-cyclopropyl-1-(4-methylphenyl)-N-[4-(pyridin-3-ylmethoxy)phenyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2nnc(C(=O)Nc3ccc(OCc4cccnc4)cc3)c2C2CC2)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-17-4-10-21(11-5-17)30-24(19-6-7-19)23(28-29-30)25(31)27-20-8-12-22(13-9-20)32-16-18-3-2-14-26-15-18/h2-5,8-15,19H,6-7,16H2,1H3,(H,27,31) |
| InChIKey | VFKZQYMHHGDXBK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |