C20H19F3N4O2S — CID 86887989
6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]methanone (PubChem CID 86887989) has the molecular formula C20H19F3N4O2S and a molecular weight of 436.46 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]methanone.
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86887989 |
| Molecular Formula | C20H19F3N4O2S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2c(s1)CCOC2)N1CCCC(c2nnc3ccc(C(F)(F)F)cn23)C1 |
| InChI | InChI=1S/C20H19F3N4O2S/c21-20(22,23)14-3-4-17-24-25-18(27(17)10-14)12-2-1-6-26(9-12)19(28)16-8-13-11-29-7-5-15(13)30-16/h3-4,8,10,12H,1-2,5-7,9,11H2 |
| InChIKey | AKVNMJNIVREIMG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |