C24H30N4OS — CID 51926449
[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 51926449) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is [(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51926449 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | CC(C)(C)[C@@H]1CCc2sc(C(=O)N3CCC[C@@H](c4nnc5ccccn45)C3)cc2C1 |
| InChI | InChI=1S/C24H30N4OS/c1-24(2,3)18-9-10-19-17(13-18)14-20(30-19)23(29)27-11-6-7-16(15-27)22-26-25-21-8-4-5-12-28(21)22/h4-5,8,12,14,16,18H,6-7,9-11,13,15H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | YEWSSJHRESCSMX-SJLPKXTDSA-N |
| XLogP | 4.96 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |