C21H24F3N5O — CID 86889051
N-[[4-(dimethylamino)phenyl]methyl]-1,3,6-trimethyl-N-(2,2,2-trifluoroethyl)pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 86889051) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1,3,6-trimethyl-N-(2,2,2-trifluoroethyl)pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1,3,6-trimethyl-N-(2,2,2-trifluoroethyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 86889051 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1,3,6-trimethyl-N-(2,2,2-trifluoroethyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(Cc2ccc(N(C)C)cc2)CC(F)(F)F)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C21H24F3N5O/c1-13-10-17(18-14(2)26-28(5)19(18)25-13)20(30)29(12-21(22,23)24)11-15-6-8-16(9-7-15)27(3)4/h6-10H,11-12H2,1-5H3 |
| InChIKey | JORLLPAPEKLJHO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|