C15H16F3N3OS — CID 126800660
N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide (PubChem CID 126800660) has the molecular formula C15H16F3N3OS and a molecular weight of 343.37 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126800660 |
| Molecular Formula | C15H16F3N3OS |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(CN(CC(F)(F)F)C(=O)c2cscn2)cc1 |
| InChI | InChI=1S/C15H16F3N3OS/c1-20(2)12-5-3-11(4-6-12)7-21(9-15(16,17)18)14(22)13-8-23-10-19-13/h3-6,8,10H,7,9H2,1-2H3 |
| InChIKey | CTCQAXPQUKGQBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|